4-hexyloxybenzoic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

4-hexyloxybenzoic acid; 4-n-hexyloxybenzoic acid
CAS RN:[1142-39-8]
Formula:C13H18O3; 222.28 g/mol
InChiKey:HBQUXMZZODHFMJ-UHFFFAOYSA-N
SMILES:CCCCCCOc1ccc(cc1)C(O)=O
Molecular structure of 4-hexyloxybenzoic acid
Melting point:104 °C

Isomers

2-butoxyethyl benzoate
Molecular structure of 2-butoxyethyl benzoate
ethyl 2-methyl-2-(4-methylphenoxy)propanoate
Molecular structure of ethyl 2-methyl-2-(4-methylphenoxy)propanoate
hexyl 4-hydroxybenzoate
Molecular structure of hexyl 4-hydroxybenzoate
4-hexyloxybenzoic acid
Molecular structure of 4-hexyloxybenzoic acid
hexyl salicylate
Molecular structure of hexyl salicylate
2-hydroxy-3,5-diisopropylbenzoic acid
Molecular structure of 2-hydroxy-3,5-diisopropylbenzoic acid
8α-methyl-6-oxo-1,2,3,4,6,7,8,8α-octahydronaphthalen-1-yl acetate
Molecular structure of 8a-methyl-6-oxo-1,2,3,4,6,7,8,8a-octahydronaphthalen-1-yl acetate
  ::     ::   Zla Mavka